CAS 1453070-16-0 is the registry number for (S)-2-Methyl-n-(3-(trifluoromethyl)benzylidene)propane-2-sulfinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
(S)-2-methyl-N-[[3-(trifluoromethyl)phenyl]methylidene]propane-2-sulfinamide (CAS 1453070-16-0) is a chemical compound with the molecular formula C12H14F3NOS and a molecular weight of 277.31 g/mol. IUPAC name: (S)-2-methyl-N-[[3-(trifluoromethyl)phenyl]methylidene]propane-2-sulfinamide. InChIKey: UHAPINQRXQBAMZ-SFHVURJKSA-N.
| Molecular formula | C12H14F3NOS |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | (S)-2-methyl-N-[[3-(trifluoromethyl)phenyl]methylidene]propane-2-sulfinamide |
| InChIKey | UHAPINQRXQBAMZ-SFHVURJKSA-N |
| SMILES | CC(C)(C)[S@](=O)N=CC1=CC(=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)