CAS 1453315-58-6 is the registry number for 2-tert-Butyl 8-ethyl 6-thia-2-azaspiro[3.4]octane-2,8-dicarboxylate 6,6-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-O-tert-butyl 8-O-ethyl 6,6-dioxo-6lambda6-thia-2-azaspiro[3.4]octane-2,8-dicarboxylate (CAS 1453315-58-6) is a chemical compound with the molecular formula C14H23NO6S and a molecular weight of 333.40 g/mol. IUPAC name: 2-O-tert-butyl 8-O-ethyl 6,6-dioxo-6lambda6-thia-2-azaspiro[3.4]octane-2,8-dicarboxylate. InChIKey: QNAYPBUXUZAOJQ-UHFFFAOYSA-N.
| Molecular formula | C14H23NO6S |
|---|---|
| Molecular weight | 333.40 g/mol |
| IUPAC name | 2-O-tert-butyl 8-O-ethyl 6,6-dioxo-6lambda6-thia-2-azaspiro[3.4]octane-2,8-dicarboxylate |
| InChIKey | QNAYPBUXUZAOJQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CS(=O)(=O)CC12CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)