CAS 1453485-59-0 appears in our catalog under these names: 4-Nitrophenyl L-Lysinate Hydrobromide, N-alpha-L-Lysine p-nitrophenyl Ester Dihydrobromide. Offered by: TRC. Available pack sizes: 100mg, 10mg.
(4-nitrophenyl) (2S)-2,6-diaminohexanoate;hydrobromide (CAS 1453485-59-0) is a chemical compound with the molecular formula C12H18BrN3O4 and a molecular weight of 348.19 g/mol. IUPAC name: (4-nitrophenyl) (2S)-2,6-diaminohexanoate;hydrobromide. InChIKey: XCOGCTWPXDUPSN-MERQFXBCSA-N.
| Molecular formula | C12H18BrN3O4 |
|---|---|
| Molecular weight | 348.19 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-2,6-diaminohexanoate;hydrobromide |
| InChIKey | XCOGCTWPXDUPSN-MERQFXBCSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC(=O)[C@H](CCCCN)N.Br |
Computed by PubChem (NCBI)