Products 145354-79-6
CAS 145354-79-6 is the registry number for (2S,4S,4'R)-2',2'-Dimethyl-(4,4'-bi-1,3-dioxolane)-2-methanol 2-Benzoate. Offered by: TRC. Available pack sizes: 500mg.
[(2S,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]methyl benzoate (CAS 145354-79-6) is a chemical compound with the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. IUPAC name: [(2S,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]methyl benzoate. InChIKey: PDYNSSGHLKHKEP-MJBXVCDLSA-N.
| Molecular formula | C16H20O6 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | [(2S,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3-dioxolan-2-yl]methyl benzoate |
| InChIKey | PDYNSSGHLKHKEP-MJBXVCDLSA-N |
| SMILES | CC1(OC[C@@H](O1)[C@@H]2CO[C@@H](O2)COC(=O)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)