Products 1453542-02-3
CAS 1453542-02-3 is the registry number for 2-Naphthylboronic acid-d7, 98.95%. Offered by: MedChemExpress. Available pack sizes: 5 g, 25 g, 1 g, 10 g, 100 mg, 500 mg, 250 mg.
(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)boronic acid (CAS 1453542-02-3) is a chemical compound with the molecular formula C10H9BO2 and a molecular weight of 179.03 g/mol. IUPAC name: (1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)boronic acid. InChIKey: KPTRDYONBVUWPD-GSNKEKJESA-N.
| Molecular formula | C10H9BO2 |
|---|---|
| Molecular weight | 179.03 g/mol |
| IUPAC name | (1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)boronic acid |
| InChIKey | KPTRDYONBVUWPD-GSNKEKJESA-N |
| SMILES | [2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])B(O)O)[2H])[2H])[2H] |
Computed by PubChem (NCBI)