CAS 1453799-57-9 is the registry number for 5-Bromo-3-chloro-6-fluoro-2-methylquinoxaline, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
5-bromo-3-chloro-6-fluoro-2-methylquinoxaline (CAS 1453799-57-9) is a chemical compound with the molecular formula C9H5BrClFN2 and a molecular weight of 275.50 g/mol. IUPAC name: 5-bromo-3-chloro-6-fluoro-2-methylquinoxaline. InChIKey: JHFZDPWHORXFFY-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClFN2 |
|---|---|
| Molecular weight | 275.50 g/mol |
| IUPAC name | 5-bromo-3-chloro-6-fluoro-2-methylquinoxaline |
| InChIKey | JHFZDPWHORXFFY-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C(=N1)C=CC(=C2Br)F)Cl |
Computed by PubChem (NCBI)