CAS 145383-62-6 is the registry number for 9-Chloro-3,7-dithia-5,10,12-triazatricyclo(6.4.0.0,2,6)dodeca-1(12),2(6),4,8,10-pentaene. Offered by: Biosynth. Available pack sizes: 25mg, 10mg.
9-chloro-3,7-dithia-5,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene (CAS 145383-62-6) is a chemical compound with the molecular formula C7H2ClN3S2 and a molecular weight of 227.7 g/mol. IUPAC name: 9-chloro-3,7-dithia-5,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene. InChIKey: SASZSVYGPZFBQV-UHFFFAOYSA-N.
| Molecular formula | C7H2ClN3S2 |
|---|---|
| Molecular weight | 227.7 g/mol |
| IUPAC name | 9-chloro-3,7-dithia-5,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene |
| InChIKey | SASZSVYGPZFBQV-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=N1)Cl)SC3=C2SC=N3 |
Computed by PubChem (NCBI)