CAS 1467836-46-9 is the registry number for 5-Chloro-4-isothiocyanatobenzo(c)(1,2,5)thiadiazole. Offered by: TRC. Available pack sizes: 2,5g.
5-chloro-4-isothiocyanato-2,1,3-benzothiadiazole (CAS 1467836-46-9) is a chemical compound with the molecular formula C7H2ClN3S2 and a molecular weight of 227.7 g/mol. IUPAC name: 5-chloro-4-isothiocyanato-2,1,3-benzothiadiazole. InChIKey: PVLDUWQLCRFHLJ-UHFFFAOYSA-N.
| Molecular formula | C7H2ClN3S2 |
|---|---|
| Molecular weight | 227.7 g/mol |
| IUPAC name | 5-chloro-4-isothiocyanato-2,1,3-benzothiadiazole |
| InChIKey | PVLDUWQLCRFHLJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C(=C1Cl)N=C=S |
Computed by PubChem (NCBI)