CAS 1453854-84-6 appears in our catalog under these names: (R)-1-(4-Chloro-3-fluorophenyl)ethane-1,2-diol, 95%, (R)-1-(4-Chloro-3-fluorophenyl)ethane-1,2-diol, 98%, (R)-1-(4-Chloro-3-fluorophenyl)ethane-1,2-diol, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg, 50mg.
(1R)-1-(4-chloro-3-fluorophenyl)ethane-1,2-diol (CAS 1453854-84-6) is a chemical compound with the molecular formula C8H8ClFO2 and a molecular weight of 190.60 g/mol. IUPAC name: (1R)-1-(4-chloro-3-fluorophenyl)ethane-1,2-diol. InChIKey: ZNGGAPYUQROFJC-QMMMGPOBSA-N.
| Molecular formula | C8H8ClFO2 |
|---|---|
| Molecular weight | 190.60 g/mol |
| IUPAC name | (1R)-1-(4-chloro-3-fluorophenyl)ethane-1,2-diol |
| InChIKey | ZNGGAPYUQROFJC-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1[C@H](CO)O)F)Cl |
Computed by PubChem (NCBI)