Products 145395-63-7

CAS 145395-63-7 is the registry number for Diethyl Butylethylmalonate-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 100 mg.

Structural formula: {0} (CAS {1})

Diethyl 2-butyl-2-(1,1,2,2,2-pentadeuterioethyl)propanedioate (CAS 145395-63-7) is a chemical compound with the molecular formula C13H24O4 and a molecular weight of 249.36 g/mol. IUPAC name: diethyl 2-butyl-2-(1,1,2,2,2-pentadeuterioethyl)propanedioate. InChIKey: OPFFBDXXUZAUAK-QKLSXCJMSA-N.

Identity
Molecular formulaC13H24O4
Molecular weight249.36 g/mol
IUPAC namediethyl 2-butyl-2-(1,1,2,2,2-pentadeuterioethyl)propanedioate
InChIKeyOPFFBDXXUZAUAK-QKLSXCJMSA-N
SMILES[2H]C([2H])([2H])C([2H])([2H])C(CCCC)(C(=O)OCC)C(=O)OCC

Computed by PubChem (NCBI)