CAS 145395-63-7 is the registry number for Diethyl Butylethylmalonate-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 100 mg.
Diethyl 2-butyl-2-(1,1,2,2,2-pentadeuterioethyl)propanedioate (CAS 145395-63-7) is a chemical compound with the molecular formula C13H24O4 and a molecular weight of 249.36 g/mol. IUPAC name: diethyl 2-butyl-2-(1,1,2,2,2-pentadeuterioethyl)propanedioate. InChIKey: OPFFBDXXUZAUAK-QKLSXCJMSA-N.
| Molecular formula | C13H24O4 |
|---|---|
| Molecular weight | 249.36 g/mol |
| IUPAC name | diethyl 2-butyl-2-(1,1,2,2,2-pentadeuterioethyl)propanedioate |
| InChIKey | OPFFBDXXUZAUAK-QKLSXCJMSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(CCCC)(C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)