CAS 145397-26-8 appears in our catalog under these names: Emtricitabine Impurity 8, Emtricitabine Impurity 41, (-)-beta-D-Dioxolane-5-fluoro Cytidine. Offered by: Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
4-amino-5-fluoro-1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidin-2-one (CAS 145397-26-8) is a chemical compound with the molecular formula C8H10FN3O4 and a molecular weight of 231.18 g/mol. IUPAC name: 4-amino-5-fluoro-1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidin-2-one. InChIKey: RJKXXGNCKMQXTH-WDSKDSINSA-N.
| Molecular formula | C8H10FN3O4 |
|---|---|
| Molecular weight | 231.18 g/mol |
| IUPAC name | 4-amino-5-fluoro-1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidin-2-one |
| InChIKey | RJKXXGNCKMQXTH-WDSKDSINSA-N |
| SMILES | C1[C@H](O[C@H](O1)CO)N2C=C(C(=NC2=O)N)F |
Computed by PubChem (NCBI)