CAS 1454288-88-0 appears in our catalog under these names: Rovazolac, 99%, Rovazolac, Rovazolac/ 99.35% (existing batch purity), Ethyl 2-[5-[3′-(methylsulfonyl)biphenyl-4-yl]-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetate, ≥99%, ≥99%, Rovazolac, 98.04%. Offered by: AmBeed, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 10mM (in 1ml ethanol).
Ethyl 2-[5-[4-(3-methylsulfonylphenyl)phenyl]-3-(trifluoromethyl)pyrazol-1-yl]acetate (CAS 1454288-88-0) is a chemical compound with the molecular formula C21H19F3N2O4S and a molecular weight of 452.4 g/mol. IUPAC name: ethyl 2-[5-[4-(3-methylsulfonylphenyl)phenyl]-3-(trifluoromethyl)pyrazol-1-yl]acetate. InChIKey: ZUMNJDGBYXHASJ-UHFFFAOYSA-N.
| Molecular formula | C21H19F3N2O4S |
|---|---|
| Molecular weight | 452.4 g/mol |
| IUPAC name | ethyl 2-[5-[4-(3-methylsulfonylphenyl)phenyl]-3-(trifluoromethyl)pyrazol-1-yl]acetate |
| InChIKey | ZUMNJDGBYXHASJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C(=CC(=N1)C(F)(F)F)C2=CC=C(C=C2)C3=CC(=CC=C3)S(=O)(=O)C |
Computed by PubChem (NCBI)