CAS 145434-22-6 appears in our catalog under these names: 2,4,6-Triisopropylphenylboronic acid methyl ester, 95-<97%, Dimethyl (2,4,6-Triisopropylphenyl)Boronate, 95+%, 95+%. Offered by: Hoffman Fine Chemicals, Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 250mg, 1g.
Dimethoxy-[2,4,6-tri(propan-2-yl)phenyl]borane (CAS 145434-22-6) is a chemical compound with the molecular formula C17H29BO2 and a molecular weight of 276.2 g/mol. IUPAC name: dimethoxy-[2,4,6-tri(propan-2-yl)phenyl]borane. InChIKey: KRQWDHHDTSORLQ-UHFFFAOYSA-N.
| Molecular formula | C17H29BO2 |
|---|---|
| Molecular weight | 276.2 g/mol |
| IUPAC name | dimethoxy-[2,4,6-tri(propan-2-yl)phenyl]borane |
| InChIKey | KRQWDHHDTSORLQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C(C)C)C(C)C)C(C)C)(OC)OC |
Computed by PubChem (NCBI)