CAS 1454585-06-8 appears in our catalog under these names: Sr-3029, 95%, SR-3029/ 100%, SR–3029, SR 3029, SR-3029 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg.
N-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]-9-(3-fluorophenyl)-2-morpholin-4-ylpurin-6-amine (CAS 1454585-06-8) is a chemical compound with the molecular formula C23H19F3N8O and a molecular weight of 480.4 g/mol. IUPAC name: N-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]-9-(3-fluorophenyl)-2-morpholin-4-ylpurin-6-amine. InChIKey: CEBMEQPREMCWOL-UHFFFAOYSA-N.
| Molecular formula | C23H19F3N8O |
|---|---|
| Molecular weight | 480.4 g/mol |
| IUPAC name | N-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]-9-(3-fluorophenyl)-2-morpholin-4-ylpurin-6-amine |
| InChIKey | CEBMEQPREMCWOL-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC(=C3C(=N2)N(C=N3)C4=CC(=CC=C4)F)NCC5=NC6=C(N5)C=CC(=C6F)F |
Computed by PubChem (NCBI)