CAS 1454681-04-9 appears in our catalog under these names: 2,3,4,5,6–Pentafluoroanilino(oxo)acetic acid, 2,3,4,5,6-PENTAFLUOROANILINO(OXO)ACETIC, 2,3,4,5,6-Pentafluoroanilino(oxo)acetic acid, 95%, 95%. Offered by: GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 1G, 100mg.
2-oxo-2-(2,3,4,5,6-pentafluoroanilino)acetic acid (CAS 1454681-04-9) is a chemical compound with the molecular formula C8H2F5NO3 and a molecular weight of 255.10 g/mol. IUPAC name: 2-oxo-2-(2,3,4,5,6-pentafluoroanilino)acetic acid. InChIKey: JHFLRXFZPBDINI-UHFFFAOYSA-N.
| Molecular formula | C8H2F5NO3 |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | 2-oxo-2-(2,3,4,5,6-pentafluoroanilino)acetic acid |
| InChIKey | JHFLRXFZPBDINI-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)NC(=O)C(=O)O |
Computed by PubChem (NCBI)