CAS 1454889-26-9 is the registry number for Bis(tosyloxy)methane-D₂, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg.
[dideuterio-(4-methylphenyl)sulfonyloxymethyl] 4-methylbenzenesulfonate (CAS 1454889-26-9) is a chemical compound with the molecular formula C15H16O6S2 and a molecular weight of 358.4 g/mol. IUPAC name: [dideuterio-(4-methylphenyl)sulfonyloxymethyl] 4-methylbenzenesulfonate. InChIKey: LEXULLPDKRNGQG-ZWGOZCLVSA-N.
| Molecular formula | C15H16O6S2 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | [dideuterio-(4-methylphenyl)sulfonyloxymethyl] 4-methylbenzenesulfonate |
| InChIKey | LEXULLPDKRNGQG-ZWGOZCLVSA-N |
| SMILES | [2H]C([2H])(OS(=O)(=O)C1=CC=C(C=C1)C)OS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)