CAS 1454924-73-2 appears in our catalog under these names: (S)–(+)–JWH 018 N–(4–hydroxypentyl) metabolite, (1-((4S)-4-Hydroxypentyl)indol-3-yl)-naphthalen-1-ylmethanone. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg.
[1-[(4S)-4-hydroxypentyl]indol-3-yl]-naphthalen-1-ylmethanone (CAS 1454924-73-2) is a chemical compound with the molecular formula C24H23NO2 and a molecular weight of 357.4 g/mol. IUPAC name: [1-[(4S)-4-hydroxypentyl]indol-3-yl]-naphthalen-1-ylmethanone. InChIKey: LLFBQQHYZJTRAS-KRWDZBQOSA-N.
| Molecular formula | C24H23NO2 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | [1-[(4S)-4-hydroxypentyl]indol-3-yl]-naphthalen-1-ylmethanone |
| InChIKey | LLFBQQHYZJTRAS-KRWDZBQOSA-N |
| SMILES | C[C@@H](CCCN1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43)O |
Computed by PubChem (NCBI)