CAS 1455091-04-9 is the registry number for methyl 2-(chloromethyl)-4-phenoxybenzoate. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(chloromethyl)-4-phenoxybenzoate (CAS 1455091-04-9) is a chemical compound with the molecular formula C15H13ClO3 and a molecular weight of 276.71 g/mol. IUPAC name: methyl 2-(chloromethyl)-4-phenoxybenzoate. InChIKey: YDISGIKGRQZDOU-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO3 |
|---|---|
| Molecular weight | 276.71 g/mol |
| IUPAC name | methyl 2-(chloromethyl)-4-phenoxybenzoate |
| InChIKey | YDISGIKGRQZDOU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)OC2=CC=CC=C2)CCl |
Computed by PubChem (NCBI)