Products 1455107-88-6

CAS 1455107-88-6 is the registry number for 3-[1-(Butylcarbamoyl)piperidin-4-yl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-[1-(butylcarbamoyl)piperidin-4-yl]propanoic acid (CAS 1455107-88-6) is a chemical compound with the molecular formula C13H24N2O3 and a molecular weight of 256.34 g/mol. IUPAC name: 3-[1-(butylcarbamoyl)piperidin-4-yl]propanoic acid. InChIKey: UBSXDFKPZNIDLN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H24N2O3
Molecular weight256.34 g/mol
IUPAC name3-[1-(butylcarbamoyl)piperidin-4-yl]propanoic acid
InChIKeyUBSXDFKPZNIDLN-UHFFFAOYSA-N
SMILESCCCCNC(=O)N1CCC(CC1)CCC(=O)O

Computed by PubChem (NCBI)