CAS 1455361-77-9 is the registry number for 3-(2-(Chloromethyl)-6-fluoro-1H-benzo[d]imidazol-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[2-(chloromethyl)-6-fluorobenzimidazol-1-yl]thiolane 1,1-dioxide (CAS 1455361-77-9) is a chemical compound with the molecular formula C12H12ClFN2O2S and a molecular weight of 302.75 g/mol. IUPAC name: 3-[2-(chloromethyl)-6-fluorobenzimidazol-1-yl]thiolane 1,1-dioxide. InChIKey: IERCZPXVIJSXKT-UHFFFAOYSA-N.
| Molecular formula | C12H12ClFN2O2S |
|---|---|
| Molecular weight | 302.75 g/mol |
| IUPAC name | 3-[2-(chloromethyl)-6-fluorobenzimidazol-1-yl]thiolane 1,1-dioxide |
| InChIKey | IERCZPXVIJSXKT-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C3=C(C=CC(=C3)F)N=C2CCl |
Computed by PubChem (NCBI)