CAS 2253629-61-5 is the registry number for N-(4-Aminophenyl)-4-fluorobenzene-1-sulfonamide hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
N-(4-aminophenyl)-4-fluorobenzenesulfonamide;hydrochloride (CAS 2253629-61-5) is a chemical compound with the molecular formula C12H12ClFN2O2S and a molecular weight of 302.75 g/mol. IUPAC name: N-(4-aminophenyl)-4-fluorobenzenesulfonamide;hydrochloride. InChIKey: ZAYNUXZUDQZVDJ-UHFFFAOYSA-N.
| Molecular formula | C12H12ClFN2O2S |
|---|---|
| Molecular weight | 302.75 g/mol |
| IUPAC name | N-(4-aminophenyl)-4-fluorobenzenesulfonamide;hydrochloride |
| InChIKey | ZAYNUXZUDQZVDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)NS(=O)(=O)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)