CAS 1455432-16-2 is the registry number for Ethyl 4,6-dioxo-6-(4'-(trifluoromethyl)-[1,1'-biphenyl]-4-yl)hexanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4,6-dioxo-6-[4-[4-(trifluoromethyl)phenyl]phenyl]hexanoate (CAS 1455432-16-2) is a chemical compound with the molecular formula C21H19F3O4 and a molecular weight of 392.4 g/mol. IUPAC name: ethyl 4,6-dioxo-6-[4-[4-(trifluoromethyl)phenyl]phenyl]hexanoate. InChIKey: LJLMHZASVSVFJO-UHFFFAOYSA-N.
| Molecular formula | C21H19F3O4 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | ethyl 4,6-dioxo-6-[4-[4-(trifluoromethyl)phenyl]phenyl]hexanoate |
| InChIKey | LJLMHZASVSVFJO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(=O)CC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)