Products 145576-25-6
CAS 145576-25-6 appears in our catalog under these names: Simvastatin EP impurity B, Simvastatin Impurity B（EP）, Simvastatin EP Impurity B (Acetyl Simvastatin), 4'-Acetyl Simvastatin, >95% (HPLC), 4′–Acetyl Simvastatin. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 10mg, 25mg, 50mg, 5mg, 2mg, 250mg.
[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-acetyloxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (CAS 145576-25-6) is a chemical compound with the molecular formula C27H40O6 and a molecular weight of 460.6 g/mol. IUPAC name: [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-acetyloxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate. InChIKey: OHVWRJDVJRNCPE-BIKFJBPRSA-N.
| Molecular formula | C27H40O6 |
|---|---|
| Molecular weight | 460.6 g/mol |
| IUPAC name | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-acetyloxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| InChIKey | OHVWRJDVJRNCPE-BIKFJBPRSA-N |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@H](C=C2[C@H]1[C@H]([C@H](C=C2)C)CC[C@@H]3C[C@H](CC(=O)O3)OC(=O)C)C |
Computed by PubChem (NCBI)
Synonyms:
Acetyl simvastatin, Simvastatin Acetate, Simvastatin acetate ester, 4'-Acetylsimvastatin, ACETYL SIMVASTATIN [USP-RS], Simvastatin specified impurity B [EP], SIMVASTATIN IMPURITY B [EP IMPURITY], ACETYL SIMVASTATIN (USP-RS), SIMVASTATIN IMPURITY B (EP IMPURITY), Simvastatin impurity, acetyl simvastatin-(USP)