CAS 1456602-51-9 appears in our catalog under these names: S 3I-1757, S3I-1757, 99.51%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 100mg, 50mg, 50 mg, 5 mg, 10 mg, 25 mg.
5-[(4-cyclohexylphenyl)methyl-(4-phenoxybenzoyl)amino]-2-hydroxybenzoic acid (CAS 1456602-51-9) is a chemical compound with the molecular formula C33H31NO5 and a molecular weight of 521.6 g/mol. IUPAC name: 5-[(4-cyclohexylphenyl)methyl-(4-phenoxybenzoyl)amino]-2-hydroxybenzoic acid. InChIKey: ZJMHQDKLWUWPDR-UHFFFAOYSA-N.
| Molecular formula | C33H31NO5 |
|---|---|
| Molecular weight | 521.6 g/mol |
| IUPAC name | 5-[(4-cyclohexylphenyl)methyl-(4-phenoxybenzoyl)amino]-2-hydroxybenzoic acid |
| InChIKey | ZJMHQDKLWUWPDR-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC=C(C=C2)CN(C3=CC(=C(C=C3)O)C(=O)O)C(=O)C4=CC=C(C=C4)OC5=CC=CC=C5 |
Computed by PubChem (NCBI)