CAS 1456736-33-6 is the registry number for (9E)-Lumefantrine, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.
2-(dibutylamino)-1-[(9E)-2,7-dichloro-9-[(4-chlorophenyl)methylidene]fluoren-4-yl]ethanol (CAS 1456736-33-6) is a chemical compound with the molecular formula C30H32Cl3NO and a molecular weight of 528.9 g/mol. IUPAC name: 2-(dibutylamino)-1-[(9E)-2,7-dichloro-9-[(4-chlorophenyl)methylidene]fluoren-4-yl]ethanol. InChIKey: DYLGFOYVTXJFJP-MFKUBSTISA-N.
| Molecular formula | C30H32Cl3NO |
|---|---|
| Molecular weight | 528.9 g/mol |
| IUPAC name | 2-(dibutylamino)-1-[(9E)-2,7-dichloro-9-[(4-chlorophenyl)methylidene]fluoren-4-yl]ethanol |
| InChIKey | DYLGFOYVTXJFJP-MFKUBSTISA-N |
| SMILES | CCCCN(CCCC)CC(C1=CC(=CC\2=C1C3=C(/C2=C\C4=CC=C(C=C4)Cl)C=C(C=C3)Cl)Cl)O |
Computed by PubChem (NCBI)