CAS 1456816-37-7 appears in our catalog under these names: (R)–4–(Anthracen–9–yl)–3–(t–butyl–2,3–dihydrobenzo(d)(1,3)oxaphosphole, (R)-AntPhos 97%, (R)-4-(Anthracen-9-yl)-3-(tert-butyl)-2,3-dihydrobenzo[d][1,3]oxaphosphole, 97%, 97%, (R)-AntPhos, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 500mg, 5g, 10g.
(3R)-4-anthracen-9-yl-3-tert-butyl-2H-1,3-benzoxaphosphole (CAS 1456816-37-7) is a chemical compound with the molecular formula C25H23OP and a molecular weight of 370.4 g/mol. IUPAC name: (3R)-4-anthracen-9-yl-3-tert-butyl-2H-1,3-benzoxaphosphole. InChIKey: HKAWVLHXUZNLPP-MHZLTWQESA-N.
| Molecular formula | C25H23OP |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | (3R)-4-anthracen-9-yl-3-tert-butyl-2H-1,3-benzoxaphosphole |
| InChIKey | HKAWVLHXUZNLPP-MHZLTWQESA-N |
| SMILES | CC(C)(C)[P@]1COC2=CC=CC(=C21)C3=C4C=CC=CC4=CC5=CC=CC=C53 |
Computed by PubChem (NCBI)