Products 1456979-21-7
CAS 1456979-21-7 is the registry number for 1-(4-Bromo-3-fluorobenzoyl)piperidine-4-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(4-bromo-3-fluorobenzoyl)piperidine-4-carbonitrile (CAS 1456979-21-7) is a chemical compound with the molecular formula C13H12BrFN2O and a molecular weight of 311.15 g/mol. IUPAC name: 1-(4-bromo-3-fluorobenzoyl)piperidine-4-carbonitrile. InChIKey: YHAPMVRAOPFUKI-UHFFFAOYSA-N.
| Molecular formula | C13H12BrFN2O |
|---|---|
| Molecular weight | 311.15 g/mol |
| IUPAC name | 1-(4-bromo-3-fluorobenzoyl)piperidine-4-carbonitrile |
| InChIKey | YHAPMVRAOPFUKI-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C#N)C(=O)C2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)