CAS 145698-42-6 appears in our catalog under these names: 4-((4-Ethylphenyl)ethynyl)-1,2-difluorobenzene, 95+%, 95+%, 4-((4-Ethylphenyl)ethynyl)-1,2-difluorobenzene, 95+%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 100g.
4-[2-(4-ethylphenyl)ethynyl]-1,2-difluorobenzene (CAS 145698-42-6) is a chemical compound with the molecular formula C16H12F2 and a molecular weight of 242.26 g/mol. IUPAC name: 4-[2-(4-ethylphenyl)ethynyl]-1,2-difluorobenzene. InChIKey: BQBFWCWEKVUCLZ-UHFFFAOYSA-N.
| Molecular formula | C16H12F2 |
|---|---|
| Molecular weight | 242.26 g/mol |
| IUPAC name | 4-[2-(4-ethylphenyl)ethynyl]-1,2-difluorobenzene |
| InChIKey | BQBFWCWEKVUCLZ-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C#CC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)