CAS 1457-11-0 appears in our catalog under these names: Udp sodium salt, 95%, Uridine 5'-(trihydrogen diphosphate) sodium salt, 97%, Uridine 5'–(trihydrogen diphosphate) sodium salt. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
Sodium [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono phosphate (CAS 1457-11-0) is a chemical compound with the molecular formula C9H13N2NaO12P2 and a molecular weight of 426.14 g/mol. IUPAC name: sodium [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono phosphate. InChIKey: OCSYTSDILWGALR-IAIGYFSYSA-M.
| Molecular formula | C9H13N2NaO12P2 |
|---|---|
| Molecular weight | 426.14 g/mol |
| IUPAC name | sodium [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono phosphate |
| InChIKey | OCSYTSDILWGALR-IAIGYFSYSA-M |
| SMILES | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)([O-])OP(=O)(O)O)O)O.[Na+] |
Computed by PubChem (NCBI)