CAS 145708-16-3 appears in our catalog under these names: Benzo[d]thiazole-6-sulfonic acid, 95%, Benzo(d)thiazole-6-sulfonic acid, 95%, Benzo(d)thiazole-6-sulfonic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 100mg, 1g, 0,5g, 50mg.
1,3-benzothiazole-6-sulfonic acid (CAS 145708-16-3) is a chemical compound with the molecular formula C7H5NO3S2 and a molecular weight of 215.3 g/mol. IUPAC name: 1,3-benzothiazole-6-sulfonic acid. InChIKey: UGDMYHVETQRVGB-UHFFFAOYSA-N.
| Molecular formula | C7H5NO3S2 |
|---|---|
| Molecular weight | 215.3 g/mol |
| IUPAC name | 1,3-benzothiazole-6-sulfonic acid |
| InChIKey | UGDMYHVETQRVGB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)O)SC=N2 |
Computed by PubChem (NCBI)