Products 145708-71-0

CAS 145708-71-0 appears in our catalog under these names: 2,5–Dibromobicyclo(4·2·0)octa–1,3,5–triene, 2,5-Dibromobicyclo[4.2.0]octa-1,3,5-triene 97%, 2,5-Dibromobicyclo[4.2.0]octa-1,3,5-triene, 98%, 98%, Bicyclo[4.2.0]octa-1,3,5-triene, 2,5-dibromo-, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 250g, 500g, 100mg.

Structural formula: {0} (CAS {1})

2,5-dibromobicyclo[4.2.0]octa-1,3,5-triene (CAS 145708-71-0) is a chemical compound with the molecular formula C8H6Br2 and a molecular weight of 261.94 g/mol. IUPAC name: 2,5-dibromobicyclo[4.2.0]octa-1,3,5-triene. InChIKey: BQHUBDRCPFXCEM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Br2
Molecular weight261.94 g/mol
IUPAC name2,5-dibromobicyclo[4.2.0]octa-1,3,5-triene
InChIKeyBQHUBDRCPFXCEM-UHFFFAOYSA-N
SMILESC1CC2=C(C=CC(=C21)Br)Br

Computed by PubChem (NCBI)