CAS 14575-74-7 appears in our catalog under these names: (±)-alpha-Fenchol, >95% (GC), (±)-a-Fenchol, >95% (GC), Alpha-fenchol. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 1g, 500mg, 10000mg, 5000mg.
(1R,2R,4S)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol (CAS 14575-74-7) is a chemical compound with the molecular formula C10H18O and a molecular weight of 154.25 g/mol. IUPAC name: (1R,2R,4S)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol. InChIKey: IAIHUHQCLTYTSF-OYNCUSHFSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 154.25 g/mol |
| IUPAC name | (1R,2R,4S)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol |
| InChIKey | IAIHUHQCLTYTSF-OYNCUSHFSA-N |
| SMILES | C[C@@]12CC[C@@H](C1)C([C@@H]2O)(C)C |
Computed by PubChem (NCBI)