CAS 145770-89-4 appears in our catalog under these names: Triclabendazole Impurity 2, N3-Methyltriclabendazole. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg.
6-chloro-5-(2,3-dichlorophenoxy)-1-methyl-2-methylsulfanylbenzimidazole (CAS 145770-89-4) is a chemical compound with the molecular formula C15H11Cl3N2OS and a molecular weight of 373.7 g/mol. IUPAC name: 6-chloro-5-(2,3-dichlorophenoxy)-1-methyl-2-methylsulfanylbenzimidazole. InChIKey: ZWTBJNLMGQSDDJ-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl3N2OS |
|---|---|
| Molecular weight | 373.7 g/mol |
| IUPAC name | 6-chloro-5-(2,3-dichlorophenoxy)-1-methyl-2-methylsulfanylbenzimidazole |
| InChIKey | ZWTBJNLMGQSDDJ-UHFFFAOYSA-N |
| SMILES | CN1C2=CC(=C(C=C2N=C1SC)OC3=C(C(=CC=C3)Cl)Cl)Cl |
Computed by PubChem (NCBI)