CAS 1457920-56-7 appears in our catalog under these names: Methyl 2-(4-fluoro-2-methylphenyl)-2-((2,2,2-trifluoroethyl)amino)acetate, 95%, Methyl 2-(4-fluoro-2-methylphenyl)-2-((2,2,2-trifluoroethyl)amino)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 2-(4-fluoro-2-methylphenyl)-2-(2,2,2-trifluoroethylamino)acetate (CAS 1457920-56-7) is a chemical compound with the molecular formula C12H13F4NO2 and a molecular weight of 279.23 g/mol. IUPAC name: methyl 2-(4-fluoro-2-methylphenyl)-2-(2,2,2-trifluoroethylamino)acetate. InChIKey: ABVZCTPSWAQDRY-UHFFFAOYSA-N.
| Molecular formula | C12H13F4NO2 |
|---|---|
| Molecular weight | 279.23 g/mol |
| IUPAC name | methyl 2-(4-fluoro-2-methylphenyl)-2-(2,2,2-trifluoroethylamino)acetate |
| InChIKey | ABVZCTPSWAQDRY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)C(C(=O)OC)NCC(F)(F)F |
Computed by PubChem (NCBI)