CAS 1458384-01-4 appears in our catalog under these names: N-(3-(Trifluoromethyl)phenyl)piperazine-1-carboxamide hydrochloride, 95%, N-(3-(Trifluoromethyl)phenyl)piperazine-1-carboxamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide;hydrochloride (CAS 1458384-01-4) is a chemical compound with the molecular formula C12H15ClF3N3O and a molecular weight of 309.71 g/mol. IUPAC name: N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide;hydrochloride. InChIKey: QSYJHECVMKRKSN-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3N3O |
|---|---|
| Molecular weight | 309.71 g/mol |
| IUPAC name | N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide;hydrochloride |
| InChIKey | QSYJHECVMKRKSN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)NC2=CC=CC(=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)