CAS 1458554-90-9 is the registry number for 3-(((1,3-Dimethyl-1H-pyrazolo[3,4-b]pyridin-5-yl)methyl)amino)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1,1-dioxothiolan-3-amine (CAS 1458554-90-9) is a chemical compound with the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. IUPAC name: N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1,1-dioxothiolan-3-amine. InChIKey: LTAFBVWGFUHIRR-UHFFFAOYSA-N.
| Molecular formula | C13H18N4O2S |
|---|---|
| Molecular weight | 294.38 g/mol |
| IUPAC name | N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-1,1-dioxothiolan-3-amine |
| InChIKey | LTAFBVWGFUHIRR-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C=N2)CNC3CCS(=O)(=O)C3)C |
Computed by PubChem (NCBI)