CAS 1491164-22-7 is the registry number for 3-((1-Isopropyl-1H-pyrazolo[3,4-b]pyridin-5-yl)amino)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,1-dioxothiolan-3-yl)-1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine (CAS 1491164-22-7) is a chemical compound with the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. IUPAC name: N-(1,1-dioxothiolan-3-yl)-1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine. InChIKey: DEIVJSLTOUSLKG-UHFFFAOYSA-N.
| Molecular formula | C13H18N4O2S |
|---|---|
| Molecular weight | 294.38 g/mol |
| IUPAC name | N-(1,1-dioxothiolan-3-yl)-1-propan-2-ylpyrazolo[3,4-b]pyridin-5-amine |
| InChIKey | DEIVJSLTOUSLKG-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=NC=C(C=C2C=N1)NC3CCS(=O)(=O)C3 |
Computed by PubChem (NCBI)