CAS 1458714-74-3 appears in our catalog under these names: Hexadecanoate–13C16 potassium, Hexadecanoate-13C16 (potassium), 98%, 98%, Hexadecanoate-13C16 (potassium), 98.40%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 5 mg, 10 mg.
Potassium (1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-13C16)hexadecanoate (CAS 1458714-74-3) is a chemical compound with the molecular formula C16H31KO2 and a molecular weight of 310.40 g/mol. IUPAC name: potassium (1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-13C16)hexadecanoate. InChIKey: MQOCIYICOGDBSG-SJIUKAAASA-M.
| Molecular formula | C16H31KO2 |
|---|---|
| Molecular weight | 310.40 g/mol |
| IUPAC name | potassium (1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-13C16)hexadecanoate |
| InChIKey | MQOCIYICOGDBSG-SJIUKAAASA-M |
| SMILES | [13CH3][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13C](=O)[O-].[K+] |
Computed by PubChem (NCBI)