Products 145903-35-1
CAS 145903-35-1 is the registry number for 4-Chloro-6-(3-chlorophenyl)-2-phenylpyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
4-chloro-6-(3-chlorophenyl)-2-phenylpyrimidine (CAS 145903-35-1) is a chemical compound with the molecular formula C16H10Cl2N2 and a molecular weight of 301.2 g/mol. IUPAC name: 4-chloro-6-(3-chlorophenyl)-2-phenylpyrimidine. InChIKey: OXGDLDPSJSWDFR-UHFFFAOYSA-N.
| Molecular formula | C16H10Cl2N2 |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | 4-chloro-6-(3-chlorophenyl)-2-phenylpyrimidine |
| InChIKey | OXGDLDPSJSWDFR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CC(=N2)Cl)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)