CAS 1459190-15-8 is the registry number for 5-Azidopentyl Methanesulfonate. Offered by: TRC. Available pack sizes: 0,5mg.
5-azidopentyl methanesulfonate (CAS 1459190-15-8) is a chemical compound with the molecular formula C6H13N3O3S and a molecular weight of 207.25 g/mol. IUPAC name: 5-azidopentyl methanesulfonate. InChIKey: MMVHFUSMTKLTRJ-UHFFFAOYSA-N.
| Molecular formula | C6H13N3O3S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 5-azidopentyl methanesulfonate |
| InChIKey | MMVHFUSMTKLTRJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)