Products 1459216-10-4
CAS 1459216-10-4 is the registry number for AGM-130. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(5-hydroxy-3-nitroso-1H-indol-2-yl)-5-nitro-1H-indol-2-ol (CAS 1459216-10-4) is a chemical compound with the molecular formula C16H10N4O5 and a molecular weight of 338.27 g/mol. IUPAC name: 3-(5-hydroxy-3-nitroso-1H-indol-2-yl)-5-nitro-1H-indol-2-ol. InChIKey: KDYHYRKDQJLNGS-UHFFFAOYSA-N.
| Molecular formula | C16H10N4O5 |
|---|---|
| Molecular weight | 338.27 g/mol |
| IUPAC name | 3-(5-hydroxy-3-nitroso-1H-indol-2-yl)-5-nitro-1H-indol-2-ol |
| InChIKey | KDYHYRKDQJLNGS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=C(N2)O)C3=C(C4=C(N3)C=CC(=C4)O)N=O |
Computed by PubChem (NCBI)