CAS 145927-73-7 appears in our catalog under these names: MS-PEG4-THP/ min. 98%, MS–PEG4–THP, MS-PEG4-THP, 95%, 95%, MS-PEG4-THP, 97.0%, MS-PEG4-THP, 97%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10mg, 25mg, 100mg, 50mg, 250mg, 1g, 1 g, 250 mg.
2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethyl methanesulfonate (CAS 145927-73-7) is a chemical compound with the molecular formula C14H28O8S and a molecular weight of 356.43 g/mol. IUPAC name: 2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethyl methanesulfonate. InChIKey: IHVHEXYPQZJGKH-UHFFFAOYSA-N.
| Molecular formula | C14H28O8S |
|---|---|
| Molecular weight | 356.43 g/mol |
| IUPAC name | 2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
| InChIKey | IHVHEXYPQZJGKH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCOCCOCCOCCOC1CCCCO1 |
Computed by PubChem (NCBI)