CAS 145963-84-4 appears in our catalog under these names: N2,N2-Dimethyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine, Triflusulfuron Metabolite IN-D8526. Offered by: TRC, HPC Standards. Available pack sizes: 10mg, 1x10mg.
2-N,2-N-dimethyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine (CAS 145963-84-4) is a chemical compound with the molecular formula C7H10F3N5O and a molecular weight of 237.18 g/mol. IUPAC name: 2-N,2-N-dimethyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine. InChIKey: CDIMJMNYIJEGBW-UHFFFAOYSA-N.
| Molecular formula | C7H10F3N5O |
|---|---|
| Molecular weight | 237.18 g/mol |
| IUPAC name | 2-N,2-N-dimethyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| InChIKey | CDIMJMNYIJEGBW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=NC(=N1)N)OCC(F)(F)F |
Computed by PubChem (NCBI)