CAS 1459754-32-5 is the registry number for Empagliflozin Impurity 70. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(2-chloro-5-iodophenyl)methyl]phenol (CAS 1459754-32-5) is a chemical compound with the molecular formula C13H10ClIO and a molecular weight of 344.57 g/mol. IUPAC name: 4-[(2-chloro-5-iodophenyl)methyl]phenol. InChIKey: KYERPXJVHWYNIT-UHFFFAOYSA-N.
| Molecular formula | C13H10ClIO |
|---|---|
| Molecular weight | 344.57 g/mol |
| IUPAC name | 4-[(2-chloro-5-iodophenyl)methyl]phenol |
| InChIKey | KYERPXJVHWYNIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=C(C=CC(=C2)I)Cl)O |
Computed by PubChem (NCBI)