CAS 1459772-15-6 is the registry number for 2-Bromo-4-((3,3-difluoroazetidin-1-yl)methyl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4-[(3,3-difluoroazetidin-1-yl)methyl]pyridine (CAS 1459772-15-6) is a chemical compound with the molecular formula C9H9BrF2N2 and a molecular weight of 263.08 g/mol. IUPAC name: 2-bromo-4-[(3,3-difluoroazetidin-1-yl)methyl]pyridine. InChIKey: FUEROEQWEPMRGK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2N2 |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | 2-bromo-4-[(3,3-difluoroazetidin-1-yl)methyl]pyridine |
| InChIKey | FUEROEQWEPMRGK-UHFFFAOYSA-N |
| SMILES | C1C(CN1CC2=CC(=NC=C2)Br)(F)F |
Computed by PubChem (NCBI)