CAS 14599-36-1 appears in our catalog under these names: 5-Oxomefruside, >95% (HPLC), 5-Oxomefruside. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
4-chloro-1-N-methyl-1-N-[(2-methyl-5-oxooxolan-2-yl)methyl]benzene-1,3-disulfonamide (CAS 14599-36-1) is a chemical compound with the molecular formula C13H17ClN2O6S2 and a molecular weight of 396.9 g/mol. IUPAC name: 4-chloro-1-N-methyl-1-N-[(2-methyl-5-oxooxolan-2-yl)methyl]benzene-1,3-disulfonamide. InChIKey: UBRIMIXGZCAQOY-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O6S2 |
|---|---|
| Molecular weight | 396.9 g/mol |
| IUPAC name | 4-chloro-1-N-methyl-1-N-[(2-methyl-5-oxooxolan-2-yl)methyl]benzene-1,3-disulfonamide |
| InChIKey | UBRIMIXGZCAQOY-UHFFFAOYSA-N |
| SMILES | CC1(CCC(=O)O1)CN(C)S(=O)(=O)C2=CC(=C(C=C2)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)