CAS 1460227-29-5 appears in our catalog under these names: Bosutinib Impurity 3, 4-((2,4-Dichloro-5-methoxyphenyl)amino)-7-hydroxy-6-methoxy-3-quinolinecarbonitrile. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
4-(2,4-dichloro-5-methoxyanilino)-7-hydroxy-6-methoxyquinoline-3-carbonitrile (CAS 1460227-29-5) is a chemical compound with the molecular formula C18H13Cl2N3O3 and a molecular weight of 390.2 g/mol. IUPAC name: 4-(2,4-dichloro-5-methoxyanilino)-7-hydroxy-6-methoxyquinoline-3-carbonitrile. InChIKey: YZDCJNFIBYGWGV-UHFFFAOYSA-N.
| Molecular formula | C18H13Cl2N3O3 |
|---|---|
| Molecular weight | 390.2 g/mol |
| IUPAC name | 4-(2,4-dichloro-5-methoxyanilino)-7-hydroxy-6-methoxyquinoline-3-carbonitrile |
| InChIKey | YZDCJNFIBYGWGV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=C(C=N2)C#N)NC3=CC(=C(C=C3Cl)Cl)OC)O |
Computed by PubChem (NCBI)