CAS 14606-42-9 appears in our catalog under these names: Triphenylsilanethiol, 95%, Triphenylsilanethiol, TRIPHENYLSILANETHIOL, 98%. Offered by: Combi-blocks, Chemat Brand, TRC, Sigma-Aldrich. Available pack sizes: 5g, on request, 100mg, 1g, 500mg.
Triphenyl(sulfanyl)silane (CAS 14606-42-9) is a chemical compound with the molecular formula C18H16SSi and a molecular weight of 292.5 g/mol. IUPAC name: triphenyl(sulfanyl)silane. InChIKey: MQDRKELSDPESDZ-UHFFFAOYSA-N.
| Molecular formula | C18H16SSi |
|---|---|
| Molecular weight | 292.5 g/mol |
| IUPAC name | triphenyl(sulfanyl)silane |
| InChIKey | MQDRKELSDPESDZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)S |
Computed by PubChem (NCBI)