CAS 146137-90-8 appears in our catalog under these names: Methyl 5-iodobenzo[b]thiophene-2-carboxylate, 97%, Methyl 5-iodobenzo(b)thiophene-2-carboxylate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5g, 2g.
Methyl 5-iodo-1-benzothiophene-2-carboxylate (CAS 146137-90-8) is a chemical compound with the molecular formula C10H7IO2S and a molecular weight of 318.13 g/mol. IUPAC name: methyl 5-iodo-1-benzothiophene-2-carboxylate. InChIKey: HEGKKJCDOJECPN-UHFFFAOYSA-N.
| Molecular formula | C10H7IO2S |
|---|---|
| Molecular weight | 318.13 g/mol |
| IUPAC name | methyl 5-iodo-1-benzothiophene-2-carboxylate |
| InChIKey | HEGKKJCDOJECPN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)C=CC(=C2)I |
Computed by PubChem (NCBI)