CAS 1461704-87-9 appears in our catalog under these names: 5-((4-Methylpiperazin-1-yl)methyl)-1,2-oxazole-3-carboxylic acid dihydrochloride, 95%, 5-((4-Methylpiperazin-1-yl)methyl)-1,2-oxazole-3-carboxylic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-[(4-methylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid;dihydrochloride (CAS 1461704-87-9) is a chemical compound with the molecular formula C10H17Cl2N3O3 and a molecular weight of 298.16 g/mol. IUPAC name: 5-[(4-methylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid;dihydrochloride. InChIKey: YKZKQQVHGHOJDL-UHFFFAOYSA-N.
| Molecular formula | C10H17Cl2N3O3 |
|---|---|
| Molecular weight | 298.16 g/mol |
| IUPAC name | 5-[(4-methylpiperazin-1-yl)methyl]-1,2-oxazole-3-carboxylic acid;dihydrochloride |
| InChIKey | YKZKQQVHGHOJDL-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC(=NO2)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)